C44H50N2O8Si — CID 10652728
1-[(2R,4S,5R)-4-benzoyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-triethylsilyloxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10652728) has the molecular formula C44H50N2O8Si and a molecular weight of 762.98 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-benzoyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-triethylsilyloxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-benzoyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-triethylsilyloxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10652728 |
| Molecular Formula | C44H50N2O8Si |
| Molecular Weight | 762.98 g/mol |
| Exact Mass | 762.33 |
| IUPAC Name | 1-[(2R,4S,5R)-4-benzoyl-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-triethylsilyloxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CC[Si](CC)(CC)O[C@@]1(C(=O)c2ccccc2)C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C44H50N2O8Si/c1-7-55(8-2,9-3)54-43(40(47)32-16-12-10-13-17-32)28-39(46-29-31(4)41(48)45-42(46)49)53-38(43)30-52-44(33-18-14-11-15-19-33,34-20-24-36(50-5)25-21-34)35-22-26-37(51-6)27-23-35/h10-27,29,38-39H,7-9,28,30H2,1-6H3,(H,45,48,49)/t38-,39-,43+/m1/s1 |
| InChIKey | KWMDAAKVLSSVNZ-FOPYAIDXSA-N |
| XLogP | 7.80 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.98 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|