C37H36ClN2O11P — CID 91321824
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (2-chlorophenyl) hydrogen phosphate (PubChem CID 91321824) has the molecular formula C37H36ClN2O11P and a molecular weight of 751.13 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (2-chlorophenyl) hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (2-chlorophenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 91321824 |
| Molecular Formula | C37H36ClN2O11P |
| Molecular Weight | 751.13 g/mol |
| Exact Mass | 750.17 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (2-chlorophenyl) hydrogen phosphate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@]2(O)OP(=O)(O)Oc2ccccc2Cl)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H36ClN2O11P/c1-24-22-40(35(42)39-34(24)41)33-21-36(43,51-52(44,45)50-31-12-8-7-11-30(31)38)32(49-33)23-48-37(25-9-5-4-6-10-25,26-13-17-28(46-2)18-14-26)27-15-19-29(47-3)20-16-27/h4-20,22,32-33,43H,21,23H2,1-3H3,(H,44,45)(H,39,41,42)/t32-,33-,36+/m1/s1 |
| InChIKey | IWGATAHXTBACOL-CQXVEOKZSA-N |
| XLogP | 5.70 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.13 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|