C38H34N6O9 — CID 146311369
[2-[[6-(2-amino-6-oxo-1H-purin-9-yl)-4-tritylmorpholin-2-yl]methoxy]-2-oxoethyl] 3,4,5-trihydroxybenzoate (PubChem CID 146311369) has the molecular formula C38H34N6O9 and a molecular weight of 718.72 g/mol. Its IUPAC name is [2-[[6-(2-amino-6-oxo-1H-purin-9-yl)-4-tritylmorpholin-2-yl]methoxy]-2-oxoethyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [2-[[6-(2-amino-6-oxo-1H-purin-9-yl)-4-tritylmorpholin-2-yl]methoxy]-2-oxoethyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 146311369 |
| Molecular Formula | C38H34N6O9 |
| Molecular Weight | 718.72 g/mol |
| Exact Mass | 718.24 |
| IUPAC Name | [2-[[6-(2-amino-6-oxo-1H-purin-9-yl)-4-tritylmorpholin-2-yl]methoxy]-2-oxoethyl] 3,4,5-trihydroxybenzoate |
| SMILES | Nc1nc2c(ncn2C2CN(C(c3ccccc3)(c3ccccc3)c3ccccc3)CC(COC(=O)COC(=O)c3cc(O)c(O)c(O)c3)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C38H34N6O9/c39-37-41-34-32(35(49)42-37)40-22-44(34)30-19-43(18-27(53-30)20-51-31(47)21-52-36(50)23-16-28(45)33(48)29(46)17-23)38(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-17,22,27,30,45-46,48H,18-21H2,(H3,39,41,42,49) |
| InChIKey | JTNVSMTZKHUBKF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 215.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.72 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|