C28H34F2N8O7 — CID 154620989
[(2S,3R,4R,5R)-3-azido-4-(1,1-difluoro-2-methoxyethoxy)-5-[2-(2-methylpropanoylamino)-6-phenylmethoxypurin-9-yl]oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 154620989) has the molecular formula C28H34F2N8O7 and a molecular weight of 632.63 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-3-azido-4-(1,1-difluoro-2-methoxyethoxy)-5-[2-(2-methylpropanoylamino)-6-phenylmethoxypurin-9-yl]oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2S,3R,4R,5R)-3-azido-4-(1,1-difluoro-2-methoxyethoxy)-5-[2-(2-methylpropanoylamino)-6-phenylmethoxypurin-9-yl]oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 154620989 |
| Molecular Formula | C28H34F2N8O7 |
| Molecular Weight | 632.63 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | [(2S,3R,4R,5R)-3-azido-4-(1,1-difluoro-2-methoxyethoxy)-5-[2-(2-methylpropanoylamino)-6-phenylmethoxypurin-9-yl]oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | COCC(F)(F)O[C@@H]1[C@H](N=[N+]=[N-])[C@@H](COC(=O)C(C)C)O[C@H]1n1cnc2c(OCc3ccccc3)nc(NC(=O)C(C)C)nc21 |
| InChI | InChI=1S/C28H34F2N8O7/c1-15(2)23(39)34-27-33-22-20(24(35-27)42-11-17-9-7-6-8-10-17)32-14-38(22)25-21(45-28(29,30)13-41-5)19(36-37-31)18(44-25)12-43-26(40)16(3)4/h6-10,14-16,18-19,21,25H,11-13H2,1-5H3,(H,33,34,35,39)/t18-,19-,21-,25-/m1/s1 |
| InChIKey | NWFPBIRZUHDDJT-JJPBMRITSA-N |
| XLogP | 4.40 |
| TPSA | 184.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|