C20H22F2N8O5 — CID 154620995
[(2S,3R,4R,5R)-5-(2-amino-6-phenylmethoxypurin-9-yl)-3-azido-4-(1,1-difluoro-2-methoxyethoxy)oxolan-2-yl]methanol (PubChem CID 154620995) has the molecular formula C20H22F2N8O5 and a molecular weight of 492.44 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-(2-amino-6-phenylmethoxypurin-9-yl)-3-azido-4-(1,1-difluoro-2-methoxyethoxy)oxolan-2-yl]methanol.
| Compound Name | [(2S,3R,4R,5R)-5-(2-amino-6-phenylmethoxypurin-9-yl)-3-azido-4-(1,1-difluoro-2-methoxyethoxy)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 154620995 |
| Molecular Formula | C20H22F2N8O5 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | [(2S,3R,4R,5R)-5-(2-amino-6-phenylmethoxypurin-9-yl)-3-azido-4-(1,1-difluoro-2-methoxyethoxy)oxolan-2-yl]methanol |
| SMILES | COCC(F)(F)O[C@@H]1[C@H](N=[N+]=[N-])[C@@H](CO)O[C@H]1n1cnc2c(OCc3ccccc3)nc(N)nc21 |
| InChI | InChI=1S/C20H22F2N8O5/c1-32-9-20(21,22)35-15-13(28-29-24)12(7-31)34-18(15)30-10-25-14-16(30)26-19(23)27-17(14)33-8-11-5-3-2-4-6-11/h2-6,10,12-13,15,18,31H,7-9H2,1H3,(H2,23,26,27)/t12-,13-,15-,18-/m1/s1 |
| InChIKey | MHGILUDTNPONKK-HOPMXRPOSA-N |
| XLogP | 2.18 |
| TPSA | 175.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|