C49H46FN5O8 — CID 155643437
[9-[(2R,3S,4R,5R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-2-(2-methylpropanoylamino)purin-6-yl] 2,2-diphenylacetate (PubChem CID 155643437) has the molecular formula C49H46FN5O8 and a molecular weight of 851.93 g/mol. Its IUPAC name is [9-[(2R,3S,4R,5R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-2-(2-methylpropanoylamino)purin-6-yl] 2,2-diphenylacetate.
| Compound Name | [9-[(2R,3S,4R,5R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-2-(2-methylpropanoylamino)purin-6-yl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 155643437 |
| Molecular Formula | C49H46FN5O8 |
| Molecular Weight | 851.93 g/mol |
| Exact Mass | 851.33 |
| IUPAC Name | [9-[(2R,3S,4R,5R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-2-(2-methylpropanoylamino)purin-6-yl] 2,2-diphenylacetate |
| SMILES | COc1ccc(C(O[C@@H]2[C@H](F)[C@@H](CO)O[C@H]2n2cnc3c(OC(=O)C(c4ccccc4)c4ccccc4)nc(NC(=O)C(C)C)nc32)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C49H46FN5O8/c1-30(2)44(57)53-48-52-43-41(45(54-48)62-47(58)39(31-14-8-5-9-15-31)32-16-10-6-11-17-32)51-29-55(43)46-42(40(50)38(28-56)61-46)63-49(33-18-12-7-13-19-33,34-20-24-36(59-3)25-21-34)35-22-26-37(60-4)27-23-35/h5-27,29-30,38-40,42,46,56H,28H2,1-4H3,(H,52,53,54,57)/t38-,40-,42-,46-/m1/s1 |
| InChIKey | MTIIBAIPKPRJHL-RTQZXFCISA-N |
| XLogP | 7.78 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.93 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|