C18H18BN8O4PS — CID 20747753
CID 20747753 (PubChem CID 20747753) has the molecular formula C18H18BN8O4PS and a molecular weight of 484.25 g/mol.
| Compound Name | CID 20747753 |
|---|---|
| PubChem CID | 20747753 |
| Molecular Formula | C18H18BN8O4PS |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | — |
| SMILES | [B]PSOCC1OC(n2cnc3c(NC(=O)c4ccccc4)ncnc32)C(OC)C1N=[N+]=[N-] |
| InChI | InChI=1S/C18H18BN8O4PS/c1-29-14-12(25-26-20)11(7-30-33-32-19)31-18(14)27-9-23-13-15(21-8-22-16(13)27)24-17(28)10-5-3-2-4-6-10/h2-6,8-9,11-12,14,18,32H,7H2,1H3,(H,21,22,24,28) |
| InChIKey | SJCDZJCGSSEYIR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|