C34H36N8O4Si — CID 15870457
N-[9-[(2R,3R,4R,5R)-5-(azidomethyl)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 15870457) has the molecular formula C34H36N8O4Si and a molecular weight of 648.80 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-5-(azidomethyl)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-5-(azidomethyl)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 15870457 |
| Molecular Formula | C34H36N8O4Si |
| Molecular Weight | 648.80 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-5-(azidomethyl)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CO[C@@H]1[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](CN=[N+]=[N-])O[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C34H36N8O4Si/c1-34(2,3)47(24-16-10-6-11-17-24,25-18-12-7-13-19-25)46-28-26(20-39-41-35)45-33(29(28)44-4)42-22-38-27-30(36-21-37-31(27)42)40-32(43)23-14-8-5-9-15-23/h5-19,21-22,26,28-29,33H,20H2,1-4H3,(H,36,37,40,43)/t26-,28-,29-,33-/m1/s1 |
| InChIKey | SCDUDWUFROOKAA-QBVBFOPXSA-N |
| XLogP | 5.25 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.80 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|