C31H25N9O6 — CID 71469619
[(2R,3R,4R,5R)-2-(azidomethyl)-4-benzoyloxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-3-yl] benzoate (PubChem CID 71469619) has the molecular formula C31H25N9O6 and a molecular weight of 619.60 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(azidomethyl)-4-benzoyloxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-2-(azidomethyl)-4-benzoyloxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 71469619 |
| Molecular Formula | C31H25N9O6 |
| Molecular Weight | 619.60 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(azidomethyl)-4-benzoyloxy-5-[6-(phenylcarbamoylamino)purin-9-yl]oxolan-3-yl] benzoate |
| SMILES | [N-]=[N+]=NC[C@H]1O[C@@H](n2cnc3c(NC(=O)Nc4ccccc4)ncnc32)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H25N9O6/c32-39-36-16-22-24(45-29(41)19-10-4-1-5-11-19)25(46-30(42)20-12-6-2-7-13-20)28(44-22)40-18-35-23-26(33-17-34-27(23)40)38-31(43)37-21-14-8-3-9-15-21/h1-15,17-18,22,24-25,28H,16H2,(H2,33,34,37,38,43)/t22-,24-,25-,28-/m1/s1 |
| InChIKey | JUVJUBMZTWUOSM-ZYWWQZICSA-N |
| XLogP | 5.13 |
| TPSA | 195.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|