C26H27N5O3 — CID 91668408
2-amino-9-[(1S,3R,4S)-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-5H-purin-6-one (PubChem CID 91668408) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-amino-9-[(1S,3R,4S)-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-5H-purin-6-one.
| Compound Name | 2-amino-9-[(1S,3R,4S)-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-5H-purin-6-one |
|---|---|
| PubChem CID | 91668408 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 2-amino-9-[(1S,3R,4S)-2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]-5H-purin-6-one |
| SMILES | C=C1[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)C[C@@H]1N1C=NC2C(=O)N=C(N)N=C21 |
| InChI | InChI=1S/C26H27N5O3/c1-17-20(15-33-13-18-8-4-2-5-9-18)22(34-14-19-10-6-3-7-11-19)12-21(17)31-16-28-23-24(31)29-26(27)30-25(23)32/h2-11,16,20-23H,1,12-15H2,(H2,27,30,32)/t20-,21-,22-,23?/m0/s1 |
| InChIKey | KYQBXQGXHVUGBM-FDWBJODVSA-N |
| XLogP | 2.70 |
| TPSA | 101.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|