C26H27N5O3 — CID 142907456
1-amino-9-[2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]purin-6-one (PubChem CID 142907456) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1-amino-9-[2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]purin-6-one.
| Compound Name | 1-amino-9-[2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]purin-6-one |
|---|---|
| PubChem CID | 142907456 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 1-amino-9-[2-methylidene-4-phenylmethoxy-3-(phenylmethoxymethyl)cyclopentyl]purin-6-one |
| SMILES | C=C1C(COCc2ccccc2)C(OCc2ccccc2)CC1n1cnc2c(=O)n(N)cnc21 |
| InChI | InChI=1S/C26H27N5O3/c1-18-21(15-33-13-19-8-4-2-5-9-19)23(34-14-20-10-6-3-7-11-20)12-22(18)30-16-28-24-25(30)29-17-31(27)26(24)32/h2-11,16-17,21-23H,1,12-15,27H2 |
| InChIKey | CAZGZQAOORHOCH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|