C25H24N4O4 — CID 162716670
9-[(1S,3S,4R)-2-oxo-3,4-bis(phenylmethoxymethyl)cyclobutyl]-1H-purin-6-one (PubChem CID 162716670) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 9-[(1S,3S,4R)-2-oxo-3,4-bis(phenylmethoxymethyl)cyclobutyl]-1H-purin-6-one.
| Compound Name | 9-[(1S,3S,4R)-2-oxo-3,4-bis(phenylmethoxymethyl)cyclobutyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 162716670 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 9-[(1S,3S,4R)-2-oxo-3,4-bis(phenylmethoxymethyl)cyclobutyl]-1H-purin-6-one |
| SMILES | O=C1[C@@H](n2cnc3c(=O)[nH]cnc32)[C@H](COCc2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C25H24N4O4/c30-23-20(14-33-12-18-9-5-2-6-10-18)19(13-32-11-17-7-3-1-4-8-17)22(23)29-16-28-21-24(29)26-15-27-25(21)31/h1-10,15-16,19-20,22H,11-14H2,(H,26,27,31)/t19-,20-,22+/m1/s1 |
| InChIKey | XILPKSATQLHHPA-SJBKTWHCSA-N |
| XLogP | 2.91 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |