C42H48N4O3SSi2 — CID 135446090
9-[(3R,4S)-3,4-bis[[tert-butyl(diphenyl)silyl]oxymethyl]thietan-2-yl]-1H-purin-6-one (PubChem CID 135446090) has the molecular formula C42H48N4O3SSi2 and a molecular weight of 745.11 g/mol. Its IUPAC name is 9-[(3R,4S)-3,4-bis[[tert-butyl(diphenyl)silyl]oxymethyl]thietan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(3R,4S)-3,4-bis[[tert-butyl(diphenyl)silyl]oxymethyl]thietan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135446090 |
| Molecular Formula | C42H48N4O3SSi2 |
| Molecular Weight | 745.11 g/mol |
| Exact Mass | 744.30 |
| IUPAC Name | 9-[(3R,4S)-3,4-bis[[tert-butyl(diphenyl)silyl]oxymethyl]thietan-2-yl]-1H-purin-6-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1SC(n2cnc3c(=O)[nH]cnc32)[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H48N4O3SSi2/c1-41(2,3)51(31-19-11-7-12-20-31,32-21-13-8-14-22-32)48-27-35-36(50-40(35)46-30-45-37-38(46)43-29-44-39(37)47)28-49-52(42(4,5)6,33-23-15-9-16-24-33)34-25-17-10-18-26-34/h7-26,29-30,35-36,40H,27-28H2,1-6H3,(H,43,44,47)/t35-,36-,40?/m1/s1 |
| InChIKey | AICGGOOBGAAVKX-OKDIQVCYSA-N |
| XLogP | 6.50 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.11 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|