C31H28Cl2N4O3S — CID 10603737
9-[(2S,3S,4S,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)thiolan-2-yl]-2,6-dichloropurine (PubChem CID 10603737) has the molecular formula C31H28Cl2N4O3S and a molecular weight of 607.56 g/mol. Its IUPAC name is 9-[(2S,3S,4S,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)thiolan-2-yl]-2,6-dichloropurine.
| Compound Name | 9-[(2S,3S,4S,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)thiolan-2-yl]-2,6-dichloropurine |
|---|---|
| PubChem CID | 10603737 |
| Molecular Formula | C31H28Cl2N4O3S |
| Molecular Weight | 607.56 g/mol |
| Exact Mass | 606.13 |
| IUPAC Name | 9-[(2S,3S,4S,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)thiolan-2-yl]-2,6-dichloropurine |
| SMILES | Clc1nc(Cl)c2ncn([C@H]3S[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@@H]3OCc3ccccc3)c2n1 |
| InChI | InChI=1S/C31H28Cl2N4O3S/c32-28-25-29(36-31(33)35-28)37(20-34-25)30-27(40-18-23-14-8-3-9-15-23)26(39-17-22-12-6-2-7-13-22)24(41-30)19-38-16-21-10-4-1-5-11-21/h1-15,20,24,26-27,30H,16-19H2/t24-,26-,27+,30+/m1/s1 |
| InChIKey | JARCDEDWIFWBHB-RUFVNJLVSA-N |
| XLogP | 7.13 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.56 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |