C39H36ClN5O4 — CID 87964231
(1R,2S,4S,5S)-2-(2-amino-6-chloropurin-9-yl)-5-[(4-methoxyphenyl)-diphenylmethoxy]-3-methylidene-4-(phenylmethoxymethyl)cyclopentan-1-ol (PubChem CID 87964231) has the molecular formula C39H36ClN5O4 and a molecular weight of 674.20 g/mol. Its IUPAC name is (1R,2S,4S,5S)-2-(2-amino-6-chloropurin-9-yl)-5-[(4-methoxyphenyl)-diphenylmethoxy]-3-methylidene-4-(phenylmethoxymethyl)cyclopentan-1-ol.
| Compound Name | (1R,2S,4S,5S)-2-(2-amino-6-chloropurin-9-yl)-5-[(4-methoxyphenyl)-diphenylmethoxy]-3-methylidene-4-(phenylmethoxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 87964231 |
| Molecular Formula | C39H36ClN5O4 |
| Molecular Weight | 674.20 g/mol |
| Exact Mass | 673.25 |
| IUPAC Name | (1R,2S,4S,5S)-2-(2-amino-6-chloropurin-9-yl)-5-[(4-methoxyphenyl)-diphenylmethoxy]-3-methylidene-4-(phenylmethoxymethyl)cyclopentan-1-ol |
| SMILES | C=C1[C@@H](COCc2ccccc2)[C@H](OC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)[C@H](O)[C@H]1n1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C39H36ClN5O4/c1-25-31(23-48-22-26-12-6-3-7-13-26)35(34(46)33(25)45-24-42-32-36(40)43-38(41)44-37(32)45)49-39(27-14-8-4-9-15-27,28-16-10-5-11-17-28)29-18-20-30(47-2)21-19-29/h3-21,24,31,33-35,46H,1,22-23H2,2H3,(H2,41,43,44)/t31-,33+,34-,35+/m1/s1 |
| InChIKey | SGPRVMOPWPWXEF-QFGDGPJGSA-N |
| XLogP | 6.75 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.20 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|