C34H30FN5O4 — CID 90248102
(3R,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-ethynyl-4-fluoro-2-methylideneoxolan-3-ol (PubChem CID 90248102) has the molecular formula C34H30FN5O4 and a molecular weight of 591.64 g/mol. Its IUPAC name is (3R,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-ethynyl-4-fluoro-2-methylideneoxolan-3-ol.
| Compound Name | (3R,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-ethynyl-4-fluoro-2-methylideneoxolan-3-ol |
|---|---|
| PubChem CID | 90248102 |
| Molecular Formula | C34H30FN5O4 |
| Molecular Weight | 591.64 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | (3R,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-4-ethynyl-4-fluoro-2-methylideneoxolan-3-ol |
| SMILES | C#C[C@@]1(F)[C@H](O)C(=C)O[C@H]1n1cnc2c(OCC)nc(NC(c3ccccc3)(c3ccccc3)c3ccc(OC)cc3)nc21 |
| InChI | InChI=1S/C34H30FN5O4/c1-5-33(35)28(41)22(3)44-31(33)40-21-36-27-29(40)37-32(38-30(27)43-6-2)39-34(23-13-9-7-10-14-23,24-15-11-8-12-16-24)25-17-19-26(42-4)20-18-25/h1,7-21,28,31,41H,3,6H2,2,4H3,(H,37,38,39)/t28-,31-,33-/m1/s1 |
| InChIKey | DKIYXGMURROPJB-INJYMACJSA-N |
| XLogP | 5.38 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|