C33H27FN4O4 — CID 138675396
(2R,3R,4S)-3-ethynyl-2-[5-fluoro-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-5-methylideneoxolane-3,4-diol (PubChem CID 138675396) has the molecular formula C33H27FN4O4 and a molecular weight of 562.60 g/mol. Its IUPAC name is (2R,3R,4S)-3-ethynyl-2-[5-fluoro-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-5-methylideneoxolane-3,4-diol.
| Compound Name | (2R,3R,4S)-3-ethynyl-2-[5-fluoro-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-5-methylideneoxolane-3,4-diol |
|---|---|
| PubChem CID | 138675396 |
| Molecular Formula | C33H27FN4O4 |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | (2R,3R,4S)-3-ethynyl-2-[5-fluoro-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-5-methylideneoxolane-3,4-diol |
| SMILES | C#C[C@@]1(O)[C@H](O)C(=C)O[C@H]1n1cc(F)c2c(NC(c3ccccc3)(c3ccccc3)c3ccc(OC)cc3)ncnc21 |
| InChI | InChI=1S/C33H27FN4O4/c1-4-32(40)28(39)21(2)42-31(32)38-19-26(34)27-29(35-20-36-30(27)38)37-33(22-11-7-5-8-12-22,23-13-9-6-10-14-23)24-15-17-25(41-3)18-16-24/h1,5-20,28,31,39-40H,2H2,3H3,(H,35,36,37)/t28-,31-,32-/m1/s1 |
| InChIKey | RVCOBWSXJOMORA-DOTMXCTOSA-N |
| XLogP | 4.75 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|