C17H19N5O5 — CID 166645589
tert-butyl N-[9-[(2R,3R,4S)-3-ethynyl-3,4-dihydroxy-5-methylideneoxolan-2-yl]purin-6-yl]carbamate (PubChem CID 166645589) has the molecular formula C17H19N5O5 and a molecular weight of 373.37 g/mol. Its IUPAC name is tert-butyl N-[9-[(2R,3R,4S)-3-ethynyl-3,4-dihydroxy-5-methylideneoxolan-2-yl]purin-6-yl]carbamate.
| Compound Name | tert-butyl N-[9-[(2R,3R,4S)-3-ethynyl-3,4-dihydroxy-5-methylideneoxolan-2-yl]purin-6-yl]carbamate |
|---|---|
| PubChem CID | 166645589 |
| Molecular Formula | C17H19N5O5 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | tert-butyl N-[9-[(2R,3R,4S)-3-ethynyl-3,4-dihydroxy-5-methylideneoxolan-2-yl]purin-6-yl]carbamate |
| SMILES | C#C[C@@]1(O)[C@H](O)C(=C)O[C@H]1n1cnc2c(NC(=O)OC(C)(C)C)ncnc21 |
| InChI | InChI=1S/C17H19N5O5/c1-6-17(25)11(23)9(2)26-14(17)22-8-20-10-12(18-7-19-13(10)22)21-15(24)27-16(3,4)5/h1,7-8,11,14,23,25H,2H2,3-5H3,(H,18,19,21,24)/t11-,14-,17-/m1/s1 |
| InChIKey | KOUFPIXHQSZZMR-JDSLSITLSA-N |
| XLogP | 0.94 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|