C20H23FIN5O5 — CID 162062552
[(2R,3S,4S,5R)-3-ethynyl-5-fluoro-5-(iodomethyl)-4-methyl-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]oxolan-3-yl] acetate (PubChem CID 162062552) has the molecular formula C20H23FIN5O5 and a molecular weight of 559.34 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3-ethynyl-5-fluoro-5-(iodomethyl)-4-methyl-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R)-3-ethynyl-5-fluoro-5-(iodomethyl)-4-methyl-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 162062552 |
| Molecular Formula | C20H23FIN5O5 |
| Molecular Weight | 559.34 g/mol |
| Exact Mass | 559.07 |
| IUPAC Name | [(2R,3S,4S,5R)-3-ethynyl-5-fluoro-5-(iodomethyl)-4-methyl-2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]purin-9-yl]oxolan-3-yl] acetate |
| SMILES | C#C[C@]1(OC(C)=O)[C@H](n2cnc3c(NC(=O)OC(C)(C)C)ncnc32)O[C@](F)(CI)[C@H]1C |
| InChI | InChI=1S/C20H23FIN5O5/c1-7-19(30-12(3)28)11(2)20(21,8-22)31-16(19)27-10-25-13-14(23-9-24-15(13)27)26-17(29)32-18(4,5)6/h1,9-11,16H,8H2,2-6H3,(H,23,24,26,29)/t11-,16+,19+,20+/m0/s1 |
| InChIKey | AHIWKQUHRYSUQC-ZPMCTHNGSA-N |
| XLogP | 3.37 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|