C37H36FN5O7 — CID 138675370
tert-butyl N-[9-[(2R,3R,4S,5S)-3-ethynyl-5-fluoro-3,4-dihydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]carbamate (PubChem CID 138675370) has the molecular formula C37H36FN5O7 and a molecular weight of 681.72 g/mol. Its IUPAC name is tert-butyl N-[9-[(2R,3R,4S,5S)-3-ethynyl-5-fluoro-3,4-dihydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]carbamate.
| Compound Name | tert-butyl N-[9-[(2R,3R,4S,5S)-3-ethynyl-5-fluoro-3,4-dihydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]carbamate |
|---|---|
| PubChem CID | 138675370 |
| Molecular Formula | C37H36FN5O7 |
| Molecular Weight | 681.72 g/mol |
| Exact Mass | 681.26 |
| IUPAC Name | tert-butyl N-[9-[(2R,3R,4S,5S)-3-ethynyl-5-fluoro-3,4-dihydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]carbamate |
| SMILES | C#C[C@]1(O)[C@H](n2cnc3c(NC(=O)OC(C)(C)C)ncnc32)O[C@](F)(COC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)[C@H]1O |
| InChI | InChI=1S/C37H36FN5O7/c1-6-35(46)31(44)36(38,49-32(35)43-23-41-28-29(39-22-40-30(28)43)42-33(45)50-34(2,3)4)21-48-37(24-13-9-7-10-14-24,25-15-11-8-12-16-25)26-17-19-27(47-5)20-18-26/h1,7-20,22-23,31-32,44,46H,21H2,2-5H3,(H,39,40,42,45)/t31-,32+,35+,36+/m0/s1 |
| InChIKey | ZPAOICQDUHZFNN-MIXYRFKRSA-N |
| XLogP | 5.11 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.72 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|