C34H36FN5O5 — CID 118683031
(2S,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-ethyl-2-fluoro-4-methyloxolane-3,4-diol (PubChem CID 118683031) has the molecular formula C34H36FN5O5 and a molecular weight of 613.69 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-ethyl-2-fluoro-4-methyloxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-ethyl-2-fluoro-4-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 118683031 |
| Molecular Formula | C34H36FN5O5 |
| Molecular Weight | 613.69 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-2-ethyl-2-fluoro-4-methyloxolane-3,4-diol |
| SMILES | CCOc1nc(NC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)nc2c1ncn2[C@@H]1O[C@](F)(CC)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C34H36FN5O5/c1-5-33(35)29(41)32(3,42)30(45-33)40-21-36-26-27(40)37-31(38-28(26)44-6-2)39-34(22-13-9-7-10-14-22,23-15-11-8-12-16-23)24-17-19-25(43-4)20-18-24/h7-21,29-30,41-42H,5-6H2,1-4H3,(H,37,38,39)/t29-,30+,32+,33+/m0/s1 |
| InChIKey | JOZZUDWDZLXTPR-GITOVDKFSA-N |
| XLogP | 5.35 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.69 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|