C37H33N5O3 — CID 151270966
2-[2-[methoxy(trityl)amino]-6-phenylmethoxypurin-9-yl]cyclopentan-1-one (PubChem CID 151270966) has the molecular formula C37H33N5O3 and a molecular weight of 595.70 g/mol. Its IUPAC name is 2-[2-[methoxy(trityl)amino]-6-phenylmethoxypurin-9-yl]cyclopentan-1-one.
| Compound Name | 2-[2-[methoxy(trityl)amino]-6-phenylmethoxypurin-9-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 151270966 |
| Molecular Formula | C37H33N5O3 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 2-[2-[methoxy(trityl)amino]-6-phenylmethoxypurin-9-yl]cyclopentan-1-one |
| SMILES | CON(c1nc(OCc2ccccc2)c2ncn(C3CCCC3=O)c2n1)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H33N5O3/c1-44-42(37(28-17-8-3-9-18-28,29-19-10-4-11-20-29)30-21-12-5-13-22-30)36-39-34-33(38-26-41(34)31-23-14-24-32(31)43)35(40-36)45-25-27-15-6-2-7-16-27/h2-13,15-22,26,31H,14,23-25H2,1H3 |
| InChIKey | NWIWORCNAONXBE-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|