C30H29BrN4O2 — CID 130427762
7-bromo-4-butoxy-N-[(4-methoxyphenyl)-diphenylmethyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 130427762) has the molecular formula C30H29BrN4O2 and a molecular weight of 557.49 g/mol. Its IUPAC name is 7-bromo-4-butoxy-N-[(4-methoxyphenyl)-diphenylmethyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 7-bromo-4-butoxy-N-[(4-methoxyphenyl)-diphenylmethyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 130427762 |
| Molecular Formula | C30H29BrN4O2 |
| Molecular Weight | 557.49 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 7-bromo-4-butoxy-N-[(4-methoxyphenyl)-diphenylmethyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | CCCCOc1nc(NC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)nn2c(Br)ccc12 |
| InChI | InChI=1S/C30H29BrN4O2/c1-3-4-21-37-28-26-19-20-27(31)35(26)34-29(32-28)33-30(22-11-7-5-8-12-22,23-13-9-6-10-14-23)24-15-17-25(36-2)18-16-24/h5-20H,3-4,21H2,1-2H3,(H,33,34) |
| InChIKey | PCWDBZDUIGBVJM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.49 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|