C36H38N3O7P — CID 90429188
[(2S)-1-methoxy-3-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2-oxopyrimidin-1-yl]propan-2-yl]oxymethyl-phenylmethoxyphosphinic acid (PubChem CID 90429188) has the molecular formula C36H38N3O7P and a molecular weight of 655.69 g/mol. Its IUPAC name is [(2S)-1-methoxy-3-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2-oxopyrimidin-1-yl]propan-2-yl]oxymethyl-phenylmethoxyphosphinic acid.
| Compound Name | [(2S)-1-methoxy-3-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2-oxopyrimidin-1-yl]propan-2-yl]oxymethyl-phenylmethoxyphosphinic acid |
|---|---|
| PubChem CID | 90429188 |
| Molecular Formula | C36H38N3O7P |
| Molecular Weight | 655.69 g/mol |
| Exact Mass | 655.24 |
| IUPAC Name | [(2S)-1-methoxy-3-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2-oxopyrimidin-1-yl]propan-2-yl]oxymethyl-phenylmethoxyphosphinic acid |
| SMILES | COC[C@H](Cn1ccc(NC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)nc1=O)OCP(=O)(O)OCc1ccccc1 |
| InChI | InChI=1S/C36H38N3O7P/c1-43-26-33(45-27-47(41,42)46-25-28-12-6-3-7-13-28)24-39-23-22-34(37-35(39)40)38-36(29-14-8-4-9-15-29,30-16-10-5-11-17-30)31-18-20-32(44-2)21-19-31/h3-23,33H,24-27H2,1-2H3,(H,41,42)(H,37,38,40)/t33-/m0/s1 |
| InChIKey | OLLMDEPOFLYYIK-XIFFEERXSA-N |
| XLogP | 6.05 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|