C32H35N3O6 — CID 90410801
N-[1-[(2S,3R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxybutyl]-2-oxopyrimidin-4-yl]acetamide (PubChem CID 90410801) has the molecular formula C32H35N3O6 and a molecular weight of 557.65 g/mol. Its IUPAC name is N-[1-[(2S,3R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxybutyl]-2-oxopyrimidin-4-yl]acetamide.
| Compound Name | N-[1-[(2S,3R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxybutyl]-2-oxopyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 90410801 |
| Molecular Formula | C32H35N3O6 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | N-[1-[(2S,3R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxybutyl]-2-oxopyrimidin-4-yl]acetamide |
| SMILES | COc1ccc(C(OC[C@H](Cn2ccc(NC(C)=O)nc2=O)[C@@H](C)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H35N3O6/c1-22(36)24(20-35-19-18-30(33-23(2)37)34-31(35)38)21-41-32(25-8-6-5-7-9-25,26-10-14-28(39-3)15-11-26)27-12-16-29(40-4)17-13-27/h5-19,22,24,36H,20-21H2,1-4H3,(H,33,34,37,38)/t22-,24+/m1/s1 |
| InChIKey | JNKAVGWNDSXNOM-VWNXMTODSA-N |
| XLogP | 4.22 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|