C40H35N3O6 — CID 132531152
N-[1-[4-[(1S)-2-[bis(4-methoxyphenyl)-phenylmethoxy]-1-hydroxyethyl]phenyl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 132531152) has the molecular formula C40H35N3O6 and a molecular weight of 653.74 g/mol. Its IUPAC name is N-[1-[4-[(1S)-2-[bis(4-methoxyphenyl)-phenylmethoxy]-1-hydroxyethyl]phenyl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[4-[(1S)-2-[bis(4-methoxyphenyl)-phenylmethoxy]-1-hydroxyethyl]phenyl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 132531152 |
| Molecular Formula | C40H35N3O6 |
| Molecular Weight | 653.74 g/mol |
| Exact Mass | 653.25 |
| IUPAC Name | N-[1-[4-[(1S)-2-[bis(4-methoxyphenyl)-phenylmethoxy]-1-hydroxyethyl]phenyl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | COc1ccc(C(OC[C@@H](O)c2ccc(-n3ccc(NC(=O)c4ccccc4)nc3=O)cc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H35N3O6/c1-47-34-21-15-31(16-22-34)40(30-11-7-4-8-12-30,32-17-23-35(48-2)24-18-32)49-27-36(44)28-13-19-33(20-14-28)43-26-25-37(42-39(43)46)41-38(45)29-9-5-3-6-10-29/h3-26,36,44H,27H2,1-2H3,(H,41,42,45,46)/t36-/m1/s1 |
| InChIKey | VIUBMBLLMNZPEO-PSXMRANNSA-N |
| XLogP | 6.54 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.74 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|