C35H32N5O5P — CID 11607013
N-[(4-methoxyphenyl)-diphenylmethyl]-9-[2-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methoxy]ethyl]purin-6-amine (PubChem CID 11607013) has the molecular formula C35H32N5O5P and a molecular weight of 633.64 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)-diphenylmethyl]-9-[2-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methoxy]ethyl]purin-6-amine.
| Compound Name | N-[(4-methoxyphenyl)-diphenylmethyl]-9-[2-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methoxy]ethyl]purin-6-amine |
|---|---|
| PubChem CID | 11607013 |
| Molecular Formula | C35H32N5O5P |
| Molecular Weight | 633.64 g/mol |
| Exact Mass | 633.21 |
| IUPAC Name | N-[(4-methoxyphenyl)-diphenylmethyl]-9-[2-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)methoxy]ethyl]purin-6-amine |
| SMILES | COc1ccc(C(Nc2ncnc3c2ncn3CCOCP2(=O)OCc3ccccc3O2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H32N5O5P/c1-42-30-18-16-29(17-19-30)35(27-11-4-2-5-12-27,28-13-6-3-7-14-28)39-33-32-34(37-23-36-33)40(24-38-32)20-21-43-25-46(41)44-22-26-10-8-9-15-31(26)45-46/h2-19,23-24H,20-22,25H2,1H3,(H,36,37,39) |
| InChIKey | HKNBNDGCLIJBLD-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.64 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|