C17H18Cl2N6O3 — CID 164575180
(2R)-2-amino-5-[2-[(6-aminopurin-9-yl)methyl]-3,4-dichlorophenoxy]pentanoic acid (PubChem CID 164575180) has the molecular formula C17H18Cl2N6O3 and a molecular weight of 425.28 g/mol. Its IUPAC name is (2R)-2-amino-5-[2-[(6-aminopurin-9-yl)methyl]-3,4-dichlorophenoxy]pentanoic acid.
| Compound Name | (2R)-2-amino-5-[2-[(6-aminopurin-9-yl)methyl]-3,4-dichlorophenoxy]pentanoic acid |
|---|---|
| PubChem CID | 164575180 |
| Molecular Formula | C17H18Cl2N6O3 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (2R)-2-amino-5-[2-[(6-aminopurin-9-yl)methyl]-3,4-dichlorophenoxy]pentanoic acid |
| SMILES | Nc1ncnc2c1ncn2Cc1c(OCCC[C@@H](N)C(=O)O)ccc(Cl)c1Cl |
| InChI | InChI=1S/C17H18Cl2N6O3/c18-10-3-4-12(28-5-1-2-11(20)17(26)27)9(13(10)19)6-25-8-24-14-15(21)22-7-23-16(14)25/h3-4,7-8,11H,1-2,5-6,20H2,(H,26,27)(H2,21,22,23)/t11-/m1/s1 |
| InChIKey | YMZUBZAHPKLBCT-LLVKDONJSA-N |
| XLogP | 2.33 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|