C19H22Cl2N8OS — CID 175291380
(2R)-5-[4-[2-[(6-aminopurin-9-yl)methyl]-3,4-dichlorophenoxy]butyl]-2-methyl-2H-1,3,4-thiadiazol-3-amine (PubChem CID 175291380) has the molecular formula C19H22Cl2N8OS and a molecular weight of 481.41 g/mol. Its IUPAC name is (2R)-5-[4-[2-[(6-aminopurin-9-yl)methyl]-3,4-dichlorophenoxy]butyl]-2-methyl-2H-1,3,4-thiadiazol-3-amine.
| Compound Name | (2R)-5-[4-[2-[(6-aminopurin-9-yl)methyl]-3,4-dichlorophenoxy]butyl]-2-methyl-2H-1,3,4-thiadiazol-3-amine |
|---|---|
| PubChem CID | 175291380 |
| Molecular Formula | C19H22Cl2N8OS |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | (2R)-5-[4-[2-[(6-aminopurin-9-yl)methyl]-3,4-dichlorophenoxy]butyl]-2-methyl-2H-1,3,4-thiadiazol-3-amine |
| SMILES | C[C@H]1SC(CCCCOc2ccc(Cl)c(Cl)c2Cn2cnc3c(N)ncnc32)=NN1N |
| InChI | InChI=1S/C19H22Cl2N8OS/c1-11-29(23)27-15(31-11)4-2-3-7-30-14-6-5-13(20)16(21)12(14)8-28-10-26-17-18(22)24-9-25-19(17)28/h5-6,9-11H,2-4,7-8,23H2,1H3,(H2,22,24,25)/t11-/m1/s1 |
| InChIKey | FPCMUWZUGTVUTI-LLVKDONJSA-N |
| XLogP | 3.89 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|