C23H26Cl2N8O3 — CID 166874038
tert-butyl N-[9-[[2,3-dichloro-6-[4-(1H-1,2,4-triazol-5-yl)butoxy]phenyl]methyl]purin-6-yl]carbamate (PubChem CID 166874038) has the molecular formula C23H26Cl2N8O3 and a molecular weight of 533.42 g/mol. Its IUPAC name is tert-butyl N-[9-[[2,3-dichloro-6-[4-(1H-1,2,4-triazol-5-yl)butoxy]phenyl]methyl]purin-6-yl]carbamate.
| Compound Name | tert-butyl N-[9-[[2,3-dichloro-6-[4-(1H-1,2,4-triazol-5-yl)butoxy]phenyl]methyl]purin-6-yl]carbamate |
|---|---|
| PubChem CID | 166874038 |
| Molecular Formula | C23H26Cl2N8O3 |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | tert-butyl N-[9-[[2,3-dichloro-6-[4-(1H-1,2,4-triazol-5-yl)butoxy]phenyl]methyl]purin-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ncnc2c1ncn2Cc1c(OCCCCc2ncn[nH]2)ccc(Cl)c1Cl |
| InChI | InChI=1S/C23H26Cl2N8O3/c1-23(2,3)36-22(34)31-20-19-21(28-11-27-20)33(13-29-19)10-14-16(8-7-15(24)18(14)25)35-9-5-4-6-17-26-12-30-32-17/h7-8,11-13H,4-6,9-10H2,1-3H3,(H,26,30,32)(H,27,28,31,34) |
| InChIKey | UOZJTXYWTPELBE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 132.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|