C25H30Cl2N8O7 — CID 175291439
tert-butyl N-[1-(2-acetylhydrazinyl)-5-[2-[(6-carbamoyloxypurin-9-yl)methyl]-3,4-dichlorophenoxy]-1-oxopentan-2-yl]carbamate (PubChem CID 175291439) has the molecular formula C25H30Cl2N8O7 and a molecular weight of 625.47 g/mol. Its IUPAC name is tert-butyl N-[1-(2-acetylhydrazinyl)-5-[2-[(6-carbamoyloxypurin-9-yl)methyl]-3,4-dichlorophenoxy]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-acetylhydrazinyl)-5-[2-[(6-carbamoyloxypurin-9-yl)methyl]-3,4-dichlorophenoxy]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 175291439 |
| Molecular Formula | C25H30Cl2N8O7 |
| Molecular Weight | 625.47 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | tert-butyl N-[1-(2-acetylhydrazinyl)-5-[2-[(6-carbamoyloxypurin-9-yl)methyl]-3,4-dichlorophenoxy]-1-oxopentan-2-yl]carbamate |
| SMILES | CC(=O)NNC(=O)C(CCCOc1ccc(Cl)c(Cl)c1Cn1cnc2c(OC(N)=O)ncnc21)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H30Cl2N8O7/c1-13(36)33-34-21(37)16(32-24(39)42-25(2,3)4)6-5-9-40-17-8-7-15(26)18(27)14(17)10-35-12-31-19-20(35)29-11-30-22(19)41-23(28)38/h7-8,11-12,16H,5-6,9-10H2,1-4H3,(H2,28,38)(H,32,39)(H,33,36)(H,34,37) |
| InChIKey | AVJJRHIYDMLLDV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 201.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|