C19H28N2O6 — CID 23258207
[(4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(phenylmethoxyamino)pentyl] acetate (PubChem CID 23258207) has the molecular formula C19H28N2O6 and a molecular weight of 380.44 g/mol. Its IUPAC name is [(4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(phenylmethoxyamino)pentyl] acetate.
| Compound Name | [(4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(phenylmethoxyamino)pentyl] acetate |
|---|---|
| PubChem CID | 23258207 |
| Molecular Formula | C19H28N2O6 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | [(4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(phenylmethoxyamino)pentyl] acetate |
| SMILES | CC(=O)OCCC[C@H](NC(=O)OC(C)(C)C)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C19H28N2O6/c1-14(22)25-12-8-11-16(20-18(24)27-19(2,3)4)17(23)21-26-13-15-9-6-5-7-10-15/h5-7,9-10,16H,8,11-13H2,1-4H3,(H,20,24)(H,21,23)/t16-/m0/s1 |
| InChIKey | QDDDAVBWCICSSS-INIZCTEOSA-N |
| XLogP | 2.47 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|