C9H11N5O2 — CID 14161254
3-[(9-methylpurin-6-yl)amino]propanoic acid (PubChem CID 14161254) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is 3-[(9-methylpurin-6-yl)amino]propanoic acid.
| Compound Name | 3-[(9-methylpurin-6-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 14161254 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 3-[(9-methylpurin-6-yl)amino]propanoic acid |
| SMILES | Cn1cnc2c(NCCC(=O)O)ncnc21 |
| InChI | InChI=1S/C9H11N5O2/c1-14-5-13-7-8(10-3-2-6(15)16)11-4-12-9(7)14/h4-5H,2-3H2,1H3,(H,15,16)(H,10,11,12) |
| InChIKey | VFCHZARWRBSHIP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |