C37H30FN5O2 — CID 44523551
N-[9-[(1R,2R,3R)-2-fluoro-4-methylidene-3-trityloxycyclopentyl]purin-6-yl]benzamide (PubChem CID 44523551) has the molecular formula C37H30FN5O2 and a molecular weight of 595.68 g/mol. Its IUPAC name is N-[9-[(1R,2R,3R)-2-fluoro-4-methylidene-3-trityloxycyclopentyl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(1R,2R,3R)-2-fluoro-4-methylidene-3-trityloxycyclopentyl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 44523551 |
| Molecular Formula | C37H30FN5O2 |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | N-[9-[(1R,2R,3R)-2-fluoro-4-methylidene-3-trityloxycyclopentyl]purin-6-yl]benzamide |
| SMILES | C=C1C[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H](F)[C@@H]1OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H30FN5O2/c1-25-22-30(43-24-41-32-34(39-23-40-35(32)43)42-36(44)26-14-6-2-7-15-26)31(38)33(25)45-37(27-16-8-3-9-17-27,28-18-10-4-11-19-28)29-20-12-5-13-21-29/h2-21,23-24,30-31,33H,1,22H2,(H,39,40,42,44)/t30-,31-,33-/m1/s1 |
| InChIKey | OAAQODNIZBGXJC-FMPXFOGJSA-N |
| XLogP | 7.30 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|