C12H13FN2O2 — CID 133323859
1-[(6-fluoro-2-pyridinyl)amino]-2-(furan-2-yl)propan-2-ol (PubChem CID 133323859) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is 1-[(6-fluoro-2-pyridinyl)amino]-2-(furan-2-yl)propan-2-ol.
| Compound Name | 1-[(6-fluoro-2-pyridinyl)amino]-2-(furan-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 133323859 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1-[(6-fluoro-2-pyridinyl)amino]-2-(furan-2-yl)propan-2-ol |
| SMILES | CC(O)(CNc1cccc(F)n1)c1ccco1 |
| InChI | InChI=1S/C12H13FN2O2/c1-12(16,9-4-3-7-17-9)8-14-11-6-2-5-10(13)15-11/h2-7,16H,8H2,1H3,(H,14,15) |
| InChIKey | CMNKGUDDPGJXFH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|