C14H18N2O3 — CID 111468723
2-[[[2-(furan-2-yl)-2-hydroxypropyl]amino]methyl]-6-methylpyridin-3-ol (PubChem CID 111468723) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[[[2-(furan-2-yl)-2-hydroxypropyl]amino]methyl]-6-methylpyridin-3-ol.
| Compound Name | 2-[[[2-(furan-2-yl)-2-hydroxypropyl]amino]methyl]-6-methylpyridin-3-ol |
|---|---|
| PubChem CID | 111468723 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-[[[2-(furan-2-yl)-2-hydroxypropyl]amino]methyl]-6-methylpyridin-3-ol |
| SMILES | Cc1ccc(O)c(CNCC(C)(O)c2ccco2)n1 |
| InChI | InChI=1S/C14H18N2O3/c1-10-5-6-12(17)11(16-10)8-15-9-14(2,18)13-4-3-7-19-13/h3-7,15,17-18H,8-9H2,1-2H3 |
| InChIKey | NCMYGCIASVBWJN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |