C14H15BrN2O3 — CID 109477092
2-bromo-N-[2-(furan-2-yl)-2-hydroxypropyl]-6-methylpyridine-3-carboxamide (PubChem CID 109477092) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is 2-bromo-N-[2-(furan-2-yl)-2-hydroxypropyl]-6-methylpyridine-3-carboxamide.
| Compound Name | 2-bromo-N-[2-(furan-2-yl)-2-hydroxypropyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109477092 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2-bromo-N-[2-(furan-2-yl)-2-hydroxypropyl]-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC(C)(O)c2ccco2)c(Br)n1 |
| InChI | InChI=1S/C14H15BrN2O3/c1-9-5-6-10(12(15)17-9)13(18)16-8-14(2,19)11-4-3-7-20-11/h3-7,19H,8H2,1-2H3,(H,16,18) |
| InChIKey | NTJIKWDZUZNFID-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|