C11H12N2O4 — CID 121085807
N-[2-(furan-2-yl)-2-hydroxypropyl]-1,2-oxazole-5-carboxamide (PubChem CID 121085807) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-hydroxypropyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[2-(furan-2-yl)-2-hydroxypropyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 121085807 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | N-[2-(furan-2-yl)-2-hydroxypropyl]-1,2-oxazole-5-carboxamide |
| SMILES | CC(O)(CNC(=O)c1ccno1)c1ccco1 |
| InChI | InChI=1S/C11H12N2O4/c1-11(15,9-3-2-6-16-9)7-12-10(14)8-4-5-13-17-8/h2-6,15H,7H2,1H3,(H,12,14) |
| InChIKey | ZSHGYFVMFIUXSU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |