C12H12BrNO4 — CID 95983656
5-bromo-N-[(2S)-2-(furan-2-yl)-2-hydroxypropyl]furan-2-carboxamide (PubChem CID 95983656) has the molecular formula C12H12BrNO4 and a molecular weight of 314.14 g/mol. Its IUPAC name is 5-bromo-N-[(2S)-2-(furan-2-yl)-2-hydroxypropyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[(2S)-2-(furan-2-yl)-2-hydroxypropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 95983656 |
| Molecular Formula | C12H12BrNO4 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 5-bromo-N-[(2S)-2-(furan-2-yl)-2-hydroxypropyl]furan-2-carboxamide |
| SMILES | C[C@](O)(CNC(=O)c1ccc(Br)o1)c1ccco1 |
| InChI | InChI=1S/C12H12BrNO4/c1-12(16,9-3-2-6-17-9)7-14-11(15)8-4-5-10(13)18-8/h2-6,16H,7H2,1H3,(H,14,15)/t12-/m0/s1 |
| InChIKey | LCIYUANNRHTMHQ-LBPRGKRZSA-N |
| XLogP | 2.27 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |