C18H17NO3 — CID 71782562
N-[2-(furan-2-yl)-2-hydroxypropyl]naphthalene-1-carboxamide (PubChem CID 71782562) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-hydroxypropyl]naphthalene-1-carboxamide.
| Compound Name | N-[2-(furan-2-yl)-2-hydroxypropyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 71782562 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-[2-(furan-2-yl)-2-hydroxypropyl]naphthalene-1-carboxamide |
| SMILES | CC(O)(CNC(=O)c1cccc2ccccc12)c1ccco1 |
| InChI | InChI=1S/C18H17NO3/c1-18(21,16-10-5-11-22-16)12-19-17(20)15-9-4-7-13-6-2-3-8-14(13)15/h2-11,21H,12H2,1H3,(H,19,20) |
| InChIKey | QDEYCPQPNPUZIB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |