C33H55N13O4 — CID 162004340
tert-butyl N-[2-[[9-(4-aminobutyl)purin-6-yl]amino]ethyl]carbamate;tert-butyl N-[2-[(9-pentylpurin-6-yl)amino]ethyl]carbamate (PubChem CID 162004340) has the molecular formula C33H55N13O4 and a molecular weight of 697.89 g/mol. Its IUPAC name is tert-butyl N-[2-[[9-(4-aminobutyl)purin-6-yl]amino]ethyl]carbamate;tert-butyl N-[2-[(9-pentylpurin-6-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[9-(4-aminobutyl)purin-6-yl]amino]ethyl]carbamate;tert-butyl N-[2-[(9-pentylpurin-6-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 162004340 |
| Molecular Formula | C33H55N13O4 |
| Molecular Weight | 697.89 g/mol |
| Exact Mass | 697.45 |
| IUPAC Name | tert-butyl N-[2-[[9-(4-aminobutyl)purin-6-yl]amino]ethyl]carbamate;tert-butyl N-[2-[(9-pentylpurin-6-yl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1ncnc2c1ncn2CCCCN.CCCCCn1cnc2c(NCCNC(=O)OC(C)(C)C)ncnc21 |
| InChI | InChI=1S/C17H28N6O2.C16H27N7O2/c1-5-6-7-10-23-12-22-13-14(20-11-21-15(13)23)18-8-9-19-16(24)25-17(2,3)4;1-16(2,3)25-15(24)19-8-7-18-13-12-14(21-10-20-13)23(11-22-12)9-5-4-6-17/h11-12H,5-10H2,1-4H3,(H,19,24)(H,18,20,21);10-11H,4-9,17H2,1-3H3,(H,19,24)(H,18,20,21) |
| InChIKey | YSPYIPGSNJMHQA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.89 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|