C8H13N7 — CID 83833748
N'-(1-methyltriazolo[4,5-d]pyrimidin-7-yl)propane-1,3-diamine (PubChem CID 83833748) has the molecular formula C8H13N7 and a molecular weight of 207.24 g/mol. Its IUPAC name is N'-(1-methyltriazolo[4,5-d]pyrimidin-7-yl)propane-1,3-diamine.
| Compound Name | N'-(1-methyltriazolo[4,5-d]pyrimidin-7-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 83833748 |
| Molecular Formula | C8H13N7 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | N'-(1-methyltriazolo[4,5-d]pyrimidin-7-yl)propane-1,3-diamine |
| SMILES | Cn1nnc2ncnc(NCCCN)c21 |
| InChI | InChI=1S/C8H13N7/c1-15-6-7(10-4-2-3-9)11-5-12-8(6)13-14-15/h5H,2-4,9H2,1H3,(H,10,11,12) |
| InChIKey | GYKQYRSPGYONRZ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|