C10H14N6 — CID 24707793
N'-(1-phenyltetrazol-5-yl)propane-1,3-diamine (PubChem CID 24707793) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is N'-(1-phenyltetrazol-5-yl)propane-1,3-diamine.
| Compound Name | N'-(1-phenyltetrazol-5-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 24707793 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | N'-(1-phenyltetrazol-5-yl)propane-1,3-diamine |
| SMILES | NCCCNc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C10H14N6/c11-7-4-8-12-10-13-14-15-16(10)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8,11H2,(H,12,13,15) |
| InChIKey | BZNAHGJKRHUWGF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|