C16H18N6O2S — CID 133412491
N-(2-methylsulfonylphenyl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine (PubChem CID 133412491) has the molecular formula C16H18N6O2S and a molecular weight of 358.43 g/mol. Its IUPAC name is N-(2-methylsulfonylphenyl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine.
| Compound Name | N-(2-methylsulfonylphenyl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 133412491 |
| Molecular Formula | C16H18N6O2S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-(2-methylsulfonylphenyl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine |
| SMILES | CS(=O)(=O)c1ccccc1NCCNc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C16H18N6O2S/c1-25(23,24)15-10-6-5-9-14(15)17-11-12-18-16-19-20-21-22(16)13-7-3-2-4-8-13/h2-10,17H,11-12H2,1H3,(H,18,19,21) |
| InChIKey | QOZAPPUGTPIVFD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|