C15H17N7O — CID 78896414
1-methyl-N-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]pyrrole-2-carboxamide (PubChem CID 78896414) has the molecular formula C15H17N7O and a molecular weight of 311.35 g/mol. Its IUPAC name is 1-methyl-N-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]pyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 78896414 |
| Molecular Formula | C15H17N7O |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 1-methyl-N-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]pyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)NCCNc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C15H17N7O/c1-21-11-5-8-13(21)14(23)16-9-10-17-15-18-19-20-22(15)12-6-3-2-4-7-12/h2-8,11H,9-10H2,1H3,(H,16,23)(H,17,18,20) |
| InChIKey | LAGOGXDBXZPLQJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|