C16H15Cl2N7O — CID 78896471
1-(3,4-dichlorophenyl)-3-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]urea (PubChem CID 78896471) has the molecular formula C16H15Cl2N7O and a molecular weight of 392.25 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 78896471 |
| Molecular Formula | C16H15Cl2N7O |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]urea |
| SMILES | O=C(NCCNc1nnnn1-c1ccccc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2N7O/c17-13-7-6-11(10-14(13)18)21-16(26)20-9-8-19-15-22-23-24-25(15)12-4-2-1-3-5-12/h1-7,10H,8-9H2,(H,19,22,24)(H2,20,21,26) |
| InChIKey | YXXIITDYUVBNLV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|