C19H20N6O — CID 95568786
trans-(1S,2S)-2-phenyl-N-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]cyclopropane-1-carboxamide (PubChem CID 95568786) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is trans-(1S,2S)-2-phenyl-N-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-phenyl-N-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95568786 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | trans-(1S,2S)-2-phenyl-N-[2-[(1-phenyltetrazol-5-yl)amino]ethyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCCNc1nnnn1-c1ccccc1)[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H20N6O/c26-18(17-13-16(17)14-7-3-1-4-8-14)20-11-12-21-19-22-23-24-25(19)15-9-5-2-6-10-15/h1-10,16-17H,11-13H2,(H,20,26)(H,21,22,24)/t16-,17+/m1/s1 |
| InChIKey | IVKSEKOWDUZSMU-SJORKVTESA-N |
| XLogP | 1.99 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|