C14H15N9O — CID 133412546
6-[2-[(1-phenyltetrazol-5-yl)amino]ethylamino]pyrazine-2-carboxamide (PubChem CID 133412546) has the molecular formula C14H15N9O and a molecular weight of 325.34 g/mol. Its IUPAC name is 6-[2-[(1-phenyltetrazol-5-yl)amino]ethylamino]pyrazine-2-carboxamide.
| Compound Name | 6-[2-[(1-phenyltetrazol-5-yl)amino]ethylamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 133412546 |
| Molecular Formula | C14H15N9O |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 6-[2-[(1-phenyltetrazol-5-yl)amino]ethylamino]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1cncc(NCCNc2nnnn2-c2ccccc2)n1 |
| InChI | InChI=1S/C14H15N9O/c15-13(24)11-8-16-9-12(19-11)17-6-7-18-14-20-21-22-23(14)10-4-2-1-3-5-10/h1-5,8-9H,6-7H2,(H2,15,24)(H,17,19)(H,18,20,22) |
| InChIKey | FSIHFSOPVLLBKV-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 136.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|