C15H14N8 — CID 133412520
6-[2-[(1-phenyltetrazol-5-yl)amino]ethylamino]pyridine-2-carbonitrile (PubChem CID 133412520) has the molecular formula C15H14N8 and a molecular weight of 306.33 g/mol. Its IUPAC name is 6-[2-[(1-phenyltetrazol-5-yl)amino]ethylamino]pyridine-2-carbonitrile.
| Compound Name | 6-[2-[(1-phenyltetrazol-5-yl)amino]ethylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133412520 |
| Molecular Formula | C15H14N8 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 6-[2-[(1-phenyltetrazol-5-yl)amino]ethylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1cccc(NCCNc2nnnn2-c2ccccc2)n1 |
| InChI | InChI=1S/C15H14N8/c16-11-12-5-4-8-14(19-12)17-9-10-18-15-20-21-22-23(15)13-6-2-1-3-7-13/h1-8H,9-10H2,(H,17,19)(H,18,20,22) |
| InChIKey | YWKHSVDMAABRCC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|