C17H16N8S — CID 133412509
N-(1-phenyltetrazol-5-yl)-N'-(3-phenyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine (PubChem CID 133412509) has the molecular formula C17H16N8S and a molecular weight of 364.44 g/mol. Its IUPAC name is N-(1-phenyltetrazol-5-yl)-N'-(3-phenyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine.
| Compound Name | N-(1-phenyltetrazol-5-yl)-N'-(3-phenyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 133412509 |
| Molecular Formula | C17H16N8S |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-(1-phenyltetrazol-5-yl)-N'-(3-phenyl-1,2,4-thiadiazol-5-yl)ethane-1,2-diamine |
| SMILES | c1ccc(-c2nsc(NCCNc3nnnn3-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H16N8S/c1-3-7-13(8-4-1)15-20-17(26-22-15)19-12-11-18-16-21-23-24-25(16)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,18,21,24)(H,19,20,22) |
| InChIKey | XEWZYEFNPAMKRQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|